C26H29N5O2S — CID 35931416
4-benzyl-2-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione (PubChem CID 35931416) has the molecular formula C26H29N5O2S and a molecular weight of 475.62 g/mol. Its IUPAC name is 4-benzyl-2-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione.
| Compound Name | 4-benzyl-2-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 35931416 |
| Molecular Formula | C26H29N5O2S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 4-benzyl-2-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione |
| SMILES | CCOc1ccccc1N1CCN(Cn2nc(-c3ccco3)n(Cc3ccccc3)c2=S)CC1 |
| InChI | InChI=1S/C26H29N5O2S/c1-2-32-23-12-7-6-11-22(23)29-16-14-28(15-17-29)20-31-26(34)30(19-21-9-4-3-5-10-21)25(27-31)24-13-8-18-33-24/h3-13,18H,2,14-17,19-20H2,1H3 |
| InChIKey | WNKNVYQJWILGFR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 51.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|