C30H35N5O2S — CID 5237304
4-benzyl-5-[(4-ethylphenoxy)methyl]-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 5237304) has the molecular formula C30H35N5O2S and a molecular weight of 529.71 g/mol. Its IUPAC name is 4-benzyl-5-[(4-ethylphenoxy)methyl]-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-benzyl-5-[(4-ethylphenoxy)methyl]-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 5237304 |
| Molecular Formula | C30H35N5O2S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 4-benzyl-5-[(4-ethylphenoxy)methyl]-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | CCc1ccc(OCc2nn(CN3CCN(c4ccccc4OC)CC3)c(=S)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H35N5O2S/c1-3-24-13-15-26(16-14-24)37-22-29-31-35(30(38)34(29)21-25-9-5-4-6-10-25)23-32-17-19-33(20-18-32)27-11-7-8-12-28(27)36-2/h4-16H,3,17-23H2,1-2H3 |
| InChIKey | VCVRIZTVYLJJLP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 47.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|