C18H20ClN5OS — CID 34508231
2-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole-3-thione (PubChem CID 34508231) has the molecular formula C18H20ClN5OS and a molecular weight of 389.91 g/mol. Its IUPAC name is 2-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 34508231 |
| Molecular Formula | C18H20ClN5OS |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccco2)nn(CN2CCN(c3ccccc3Cl)CC2)c1=S |
| InChI | InChI=1S/C18H20ClN5OS/c1-21-17(16-7-4-12-25-16)20-24(18(21)26)13-22-8-10-23(11-9-22)15-6-3-2-5-14(15)19/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | MEYXAVUJEZLPIC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|