C21H24ClN5S — CID 30743447
2-[(4-benzylpiperazin-1-yl)methyl]-5-(2-chlorophenyl)-4-methyl-1,2,4-triazole-3-thione (PubChem CID 30743447) has the molecular formula C21H24ClN5S and a molecular weight of 413.98 g/mol. Its IUPAC name is 2-[(4-benzylpiperazin-1-yl)methyl]-5-(2-chlorophenyl)-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-benzylpiperazin-1-yl)methyl]-5-(2-chlorophenyl)-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 30743447 |
| Molecular Formula | C21H24ClN5S |
| Molecular Weight | 413.98 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-[(4-benzylpiperazin-1-yl)methyl]-5-(2-chlorophenyl)-4-methyl-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccccc2Cl)nn(CN2CCN(Cc3ccccc3)CC2)c1=S |
| InChI | InChI=1S/C21H24ClN5S/c1-24-20(18-9-5-6-10-19(18)22)23-27(21(24)28)16-26-13-11-25(12-14-26)15-17-7-3-2-4-8-17/h2-10H,11-16H2,1H3 |
| InChIKey | LNVGGGKUYKNAOB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.98 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|