C15H20FN5O2S2 — CID 35946899
5-(2-fluorophenyl)-4-methyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 35946899) has the molecular formula C15H20FN5O2S2 and a molecular weight of 385.49 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-4-methyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-fluorophenyl)-4-methyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 35946899 |
| Molecular Formula | C15H20FN5O2S2 |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 5-(2-fluorophenyl)-4-methyl-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccccc2F)nn(CN2CCN(S(C)(=O)=O)CC2)c1=S |
| InChI | InChI=1S/C15H20FN5O2S2/c1-18-14(12-5-3-4-6-13(12)16)17-21(15(18)24)11-19-7-9-20(10-8-19)25(2,22)23/h3-6H,7-11H2,1-2H3 |
| InChIKey | KACAGPXUWDJLJD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|