C19H25FN4OS — CID 2357253
4-cyclohexyl-5-(2-fluorophenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 2357253) has the molecular formula C19H25FN4OS and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-cyclohexyl-5-(2-fluorophenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 4-cyclohexyl-5-(2-fluorophenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2357253 |
| Molecular Formula | C19H25FN4OS |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 4-cyclohexyl-5-(2-fluorophenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | Fc1ccccc1-c1nn(CN2CCOCC2)c(=S)n1C1CCCCC1 |
| InChI | InChI=1S/C19H25FN4OS/c20-17-9-5-4-8-16(17)18-21-23(14-22-10-12-25-13-11-22)19(26)24(18)15-6-2-1-3-7-15/h4-5,8-9,15H,1-3,6-7,10-14H2 |
| InChIKey | MGUKDJQIPNMPNH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|