C25H31N5O2S — CID 17479043
N-[1-[[4-cyclohexyl-3-(furan-2-yl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidin-4-yl]benzamide (PubChem CID 17479043) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[1-[[4-cyclohexyl-3-(furan-2-yl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[[4-cyclohexyl-3-(furan-2-yl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 17479043 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[1-[[4-cyclohexyl-3-(furan-2-yl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(Cn2nc(-c3ccco3)n(C3CCCCC3)c2=S)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H31N5O2S/c31-24(19-8-3-1-4-9-19)26-20-13-15-28(16-14-20)18-29-25(33)30(21-10-5-2-6-11-21)23(27-29)22-12-7-17-32-22/h1,3-4,7-9,12,17,20-21H,2,5-6,10-11,13-16,18H2,(H,26,31) |
| InChIKey | WUENLMOSMKSVOV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|