C16H20N4OS2 — CID 17461272
N-[1-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]piperidin-4-yl]benzamide (PubChem CID 17461272) has the molecular formula C16H20N4OS2 and a molecular weight of 348.50 g/mol. Its IUPAC name is N-[1-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 17461272 |
| Molecular Formula | C16H20N4OS2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[1-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]piperidin-4-yl]benzamide |
| SMILES | Cc1nn(CN2CCC(NC(=O)c3ccccc3)CC2)c(=S)s1 |
| InChI | InChI=1S/C16H20N4OS2/c1-12-18-20(16(22)23-12)11-19-9-7-14(8-10-19)17-15(21)13-5-3-2-4-6-13/h2-6,14H,7-11H2,1H3,(H,17,21) |
| InChIKey | SXGMHMLWWLMALO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|