C21H21ClN4O2S — CID 26000781
N-[1-[[5-(3-chlorophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidin-4-yl]benzamide (PubChem CID 26000781) has the molecular formula C21H21ClN4O2S and a molecular weight of 428.95 g/mol. Its IUPAC name is N-[1-[[5-(3-chlorophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[[5-(3-chlorophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 26000781 |
| Molecular Formula | C21H21ClN4O2S |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[1-[[5-(3-chlorophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(Cn2nc(-c3cccc(Cl)c3)oc2=S)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H21ClN4O2S/c22-17-8-4-7-16(13-17)20-24-26(21(29)28-20)14-25-11-9-18(10-12-25)23-19(27)15-5-2-1-3-6-15/h1-8,13,18H,9-12,14H2,(H,23,27) |
| InChIKey | BSTFJSUFDNTLML-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|