C23H24N4O4S — CID 55861463
N-[1-[[5-(1,3-benzodioxol-5-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidin-4-yl]-2-methylbenzamide (PubChem CID 55861463) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is N-[1-[[5-(1,3-benzodioxol-5-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidin-4-yl]-2-methylbenzamide.
| Compound Name | N-[1-[[5-(1,3-benzodioxol-5-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidin-4-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 55861463 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[1-[[5-(1,3-benzodioxol-5-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidin-4-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC1CCN(Cn2nc(-c3ccc4c(c3)OCO4)oc2=S)CC1 |
| InChI | InChI=1S/C23H24N4O4S/c1-15-4-2-3-5-18(15)21(28)24-17-8-10-26(11-9-17)13-27-23(32)31-22(25-27)16-6-7-19-20(12-16)30-14-29-19/h2-7,12,17H,8-11,13-14H2,1H3,(H,24,28) |
| InChIKey | BZIHWFXMCBKLHR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|