C22H29N5OS — CID 55861849
N-[1-[(3-cyclopropyl-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]-2-methylbenzamide (PubChem CID 55861849) has the molecular formula C22H29N5OS and a molecular weight of 411.58 g/mol. Its IUPAC name is N-[1-[(3-cyclopropyl-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]-2-methylbenzamide.
| Compound Name | N-[1-[(3-cyclopropyl-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 55861849 |
| Molecular Formula | C22H29N5OS |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-[1-[(3-cyclopropyl-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]-2-methylbenzamide |
| SMILES | C=CCn1c(C2CC2)nn(CN2CCC(NC(=O)c3ccccc3C)CC2)c1=S |
| InChI | InChI=1S/C22H29N5OS/c1-3-12-26-20(17-8-9-17)24-27(22(26)29)15-25-13-10-18(11-14-25)23-21(28)19-7-5-4-6-16(19)2/h3-7,17-18H,1,8-15H2,2H3,(H,23,28) |
| InChIKey | NUIYXKOIWFLZBO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|