C16H18BrN3O3S — CID 9243716
methyl 1-[[5-(3-bromophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidine-4-carboxylate (PubChem CID 9243716) has the molecular formula C16H18BrN3O3S and a molecular weight of 412.31 g/mol. Its IUPAC name is methyl 1-[[5-(3-bromophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[5-(3-bromophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 9243716 |
| Molecular Formula | C16H18BrN3O3S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | methyl 1-[[5-(3-bromophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(Cn2nc(-c3cccc(Br)c3)oc2=S)CC1 |
| InChI | InChI=1S/C16H18BrN3O3S/c1-22-15(21)11-5-7-19(8-6-11)10-20-16(24)23-14(18-20)12-3-2-4-13(17)9-12/h2-4,9,11H,5-8,10H2,1H3 |
| InChIKey | XXSKZAFKZAHBBO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|