C19H26N4O2S2 — CID 9320120
azepan-1-yl-[1-[(2-sulfanylidene-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)methyl]piperidin-4-yl]methanone (PubChem CID 9320120) has the molecular formula C19H26N4O2S2 and a molecular weight of 406.58 g/mol. Its IUPAC name is azepan-1-yl-[1-[(2-sulfanylidene-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)methyl]piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[(2-sulfanylidene-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)methyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 9320120 |
| Molecular Formula | C19H26N4O2S2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | azepan-1-yl-[1-[(2-sulfanylidene-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)methyl]piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(Cn2nc(-c3cccs3)oc2=S)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C19H26N4O2S2/c24-18(22-9-3-1-2-4-10-22)15-7-11-21(12-8-15)14-23-19(26)25-17(20-23)16-6-5-13-27-16/h5-6,13,15H,1-4,7-12,14H2 |
| InChIKey | JJMRXPRPEWCLCU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|