C19H21N3O3S2 — CID 9285326
3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione (PubChem CID 9285326) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9285326 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-thiophen-2-yl-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(OC)c([C@H]2CCCN2Cn2nc(-c3cccs3)oc2=S)c1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-23-13-7-8-16(24-2)14(11-13)15-5-3-9-21(15)12-22-19(26)25-18(20-22)17-6-4-10-27-17/h4,6-8,10-11,15H,3,5,9,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | VENWVTVNPZNPAB-OAHLLOKOSA-N |
| XLogP | 4.75 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|