C21H26N4O2S2 — CID 17464346
2-[[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-4-ethyl-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 17464346) has the molecular formula C21H26N4O2S2 and a molecular weight of 430.60 g/mol. Its IUPAC name is 2-[[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-4-ethyl-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-4-ethyl-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17464346 |
| Molecular Formula | C21H26N4O2S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-[[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-4-ethyl-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2cccs2)nn(CN2CCCC2c2ccc(OC)cc2OC)c1=S |
| InChI | InChI=1S/C21H26N4O2S2/c1-4-24-20(19-8-6-12-29-19)22-25(21(24)28)14-23-11-5-7-17(23)16-10-9-15(26-2)13-18(16)27-3/h6,8-10,12-13,17H,4-5,7,11,14H2,1-3H3 |
| InChIKey | WEALUBHYMAPBQJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 44.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|