C17H20N4OS2 — CID 17439223
4-ethyl-5-(furan-2-yl)-2-[(2-thiophen-2-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 17439223) has the molecular formula C17H20N4OS2 and a molecular weight of 360.51 g/mol. Its IUPAC name is 4-ethyl-5-(furan-2-yl)-2-[(2-thiophen-2-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-ethyl-5-(furan-2-yl)-2-[(2-thiophen-2-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17439223 |
| Molecular Formula | C17H20N4OS2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-ethyl-5-(furan-2-yl)-2-[(2-thiophen-2-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccco2)nn(CN2CCCC2c2cccs2)c1=S |
| InChI | InChI=1S/C17H20N4OS2/c1-2-20-16(14-7-4-10-22-14)18-21(17(20)23)12-19-9-3-6-13(19)15-8-5-11-24-15/h4-5,7-8,10-11,13H,2-3,6,9,12H2,1H3 |
| InChIKey | WAWNEJWJSXDUCC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 39.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|