C19H21FN4O2S — CID 134020098
4-ethyl-2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione (PubChem CID 134020098) has the molecular formula C19H21FN4O2S and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-ethyl-2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione.
| Compound Name | 4-ethyl-2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 134020098 |
| Molecular Formula | C19H21FN4O2S |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-ethyl-2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccco2)nn(CN2CCOC(c3ccc(F)cc3)C2)c1=S |
| InChI | InChI=1S/C19H21FN4O2S/c1-2-23-18(16-4-3-10-25-16)21-24(19(23)27)13-22-9-11-26-17(12-22)14-5-7-15(20)8-6-14/h3-8,10,17H,2,9,11-13H2,1H3 |
| InChIKey | XEPVIUSRYOIHJG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|