C21H22FN5OS — CID 78849101
2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazole-3-thione (PubChem CID 78849101) has the molecular formula C21H22FN5OS and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 78849101 |
| Molecular Formula | C21H22FN5OS |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)morpholin-4-yl]methyl]-4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(-c2cccnc2)nn(CN2CCOC(c3ccc(F)cc3)C2)c1=S |
| InChI | InChI=1S/C21H22FN5OS/c1-2-10-26-20(17-4-3-9-23-13-17)24-27(21(26)29)15-25-11-12-28-19(14-25)16-5-7-18(22)8-6-16/h2-9,13,19H,1,10-12,14-15H2 |
| InChIKey | ININDAZVQZYGQK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|