C19H21N3O2S2 — CID 9244785
5-(2-ethoxyphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 9244785) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 5-(2-ethoxyphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2-ethoxyphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9244785 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 5-(2-ethoxyphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | CCOc1ccccc1-c1nn(CN2CCC[C@H]2c2cccs2)c(=S)o1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-2-23-16-9-4-3-7-14(16)18-20-22(19(25)24-18)13-21-11-5-8-15(21)17-10-6-12-26-17/h3-4,6-7,9-10,12,15H,2,5,8,11,13H2,1H3/t15-/m0/s1 |
| InChIKey | QTZNWVBYWGPFLD-HNNXBMFYSA-N |
| XLogP | 5.13 |
| TPSA | 43.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|