C19H25NO2S — CID 92878171
2-ethoxy-6-[[(2S)-2-thiophen-2-ylazepan-1-yl]methyl]phenol (PubChem CID 92878171) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is 2-ethoxy-6-[[(2S)-2-thiophen-2-ylazepan-1-yl]methyl]phenol.
| Compound Name | 2-ethoxy-6-[[(2S)-2-thiophen-2-ylazepan-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 92878171 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-ethoxy-6-[[(2S)-2-thiophen-2-ylazepan-1-yl]methyl]phenol |
| SMILES | CCOc1cccc(CN2CCCCC[C@H]2c2cccs2)c1O |
| InChI | InChI=1S/C19H25NO2S/c1-2-22-17-10-6-8-15(19(17)21)14-20-12-5-3-4-9-16(20)18-11-7-13-23-18/h6-8,10-11,13,16,21H,2-5,9,12,14H2,1H3/t16-/m0/s1 |
| InChIKey | NCXDVPPJAOYUQV-INIZCTEOSA-N |
| XLogP | 4.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|