C17H20FNS — CID 92878201
(2S)-1-[(2-fluorophenyl)methyl]-2-thiophen-2-ylazepane (PubChem CID 92878201) has the molecular formula C17H20FNS and a molecular weight of 289.42 g/mol. Its IUPAC name is (2S)-1-[(2-fluorophenyl)methyl]-2-thiophen-2-ylazepane.
| Compound Name | (2S)-1-[(2-fluorophenyl)methyl]-2-thiophen-2-ylazepane |
|---|---|
| PubChem CID | 92878201 |
| Molecular Formula | C17H20FNS |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2S)-1-[(2-fluorophenyl)methyl]-2-thiophen-2-ylazepane |
| SMILES | Fc1ccccc1CN1CCCCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C17H20FNS/c18-15-8-4-3-7-14(15)13-19-11-5-1-2-9-16(19)17-10-6-12-20-17/h3-4,6-8,10,12,16H,1-2,5,9,11,13H2/t16-/m0/s1 |
| InChIKey | KDFURRHKRDQQAL-INIZCTEOSA-N |
| XLogP | 5.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |