C19H25NO3S — CID 46366495
2,6-dimethoxy-4-[(2-thiophen-2-ylazepan-1-yl)methyl]phenol (PubChem CID 46366495) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(2-thiophen-2-ylazepan-1-yl)methyl]phenol.
| Compound Name | 2,6-dimethoxy-4-[(2-thiophen-2-ylazepan-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 46366495 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2,6-dimethoxy-4-[(2-thiophen-2-ylazepan-1-yl)methyl]phenol |
| SMILES | COc1cc(CN2CCCCCC2c2cccs2)cc(OC)c1O |
| InChI | InChI=1S/C19H25NO3S/c1-22-16-11-14(12-17(23-2)19(16)21)13-20-9-5-3-4-7-15(20)18-8-6-10-24-18/h6,8,10-12,15,21H,3-5,7,9,13H2,1-2H3 |
| InChIKey | IXRNUNUKDMSAQJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |