C19H25NS — CID 46366576
1-[(4-ethylphenyl)methyl]-2-thiophen-2-ylazepane (PubChem CID 46366576) has the molecular formula C19H25NS and a molecular weight of 299.48 g/mol. Its IUPAC name is 1-[(4-ethylphenyl)methyl]-2-thiophen-2-ylazepane.
| Compound Name | 1-[(4-ethylphenyl)methyl]-2-thiophen-2-ylazepane |
|---|---|
| PubChem CID | 46366576 |
| Molecular Formula | C19H25NS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-[(4-ethylphenyl)methyl]-2-thiophen-2-ylazepane |
| SMILES | CCc1ccc(CN2CCCCCC2c2cccs2)cc1 |
| InChI | InChI=1S/C19H25NS/c1-2-16-9-11-17(12-10-16)15-20-13-5-3-4-7-18(20)19-8-6-14-21-19/h6,8-12,14,18H,2-5,7,13,15H2,1H3 |
| InChIKey | AKDVLIQYMKYUTQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |