C15H19NS2 — CID 92878241
(2R)-2-thiophen-2-yl-1-(thiophen-2-ylmethyl)azepane (PubChem CID 92878241) has the molecular formula C15H19NS2 and a molecular weight of 277.46 g/mol. Its IUPAC name is (2R)-2-thiophen-2-yl-1-(thiophen-2-ylmethyl)azepane.
| Compound Name | (2R)-2-thiophen-2-yl-1-(thiophen-2-ylmethyl)azepane |
|---|---|
| PubChem CID | 92878241 |
| Molecular Formula | C15H19NS2 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (2R)-2-thiophen-2-yl-1-(thiophen-2-ylmethyl)azepane |
| SMILES | c1csc(CN2CCCCC[C@@H]2c2cccs2)c1 |
| InChI | InChI=1S/C15H19NS2/c1-2-7-14(15-8-5-11-18-15)16(9-3-1)12-13-6-4-10-17-13/h4-6,8,10-11,14H,1-3,7,9,12H2/t14-/m1/s1 |
| InChIKey | FBNWIKFDFYIHBM-CQSZACIVSA-N |
| XLogP | 4.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |