C19H25NO2S — CID 92878118
(2R)-1-[(2,4-dimethoxyphenyl)methyl]-2-thiophen-2-ylazepane (PubChem CID 92878118) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is (2R)-1-[(2,4-dimethoxyphenyl)methyl]-2-thiophen-2-ylazepane.
| Compound Name | (2R)-1-[(2,4-dimethoxyphenyl)methyl]-2-thiophen-2-ylazepane |
|---|---|
| PubChem CID | 92878118 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (2R)-1-[(2,4-dimethoxyphenyl)methyl]-2-thiophen-2-ylazepane |
| SMILES | COc1ccc(CN2CCCCC[C@@H]2c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C19H25NO2S/c1-21-16-10-9-15(18(13-16)22-2)14-20-11-5-3-4-7-17(20)19-8-6-12-23-19/h6,8-10,12-13,17H,3-5,7,11,14H2,1-2H3/t17-/m1/s1 |
| InChIKey | ACTJQYZZPBITSM-QGZVFWFLSA-N |
| XLogP | 4.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |