C23H28N2O3S — CID 92877977
methyl 2-[5-methoxy-3-[[(2S)-2-thiophen-2-ylazepan-1-yl]methyl]indol-1-yl]acetate (PubChem CID 92877977) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is methyl 2-[5-methoxy-3-[[(2S)-2-thiophen-2-ylazepan-1-yl]methyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[5-methoxy-3-[[(2S)-2-thiophen-2-ylazepan-1-yl]methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 92877977 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | methyl 2-[5-methoxy-3-[[(2S)-2-thiophen-2-ylazepan-1-yl]methyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(CN2CCCCC[C@H]2c2cccs2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C23H28N2O3S/c1-27-18-9-10-20-19(13-18)17(15-25(20)16-23(26)28-2)14-24-11-5-3-4-7-21(24)22-8-6-12-29-22/h6,8-10,12-13,15,21H,3-5,7,11,14,16H2,1-2H3/t21-/m0/s1 |
| InChIKey | RBZMRDCFWMMBFD-NRFANRHFSA-N |
| XLogP | 5.00 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |