C24H26N2O2S — CID 8709609
N-[(R)-(4-methoxyphenyl)-phenylmethyl]-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide (PubChem CID 8709609) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[(R)-(4-methoxyphenyl)-phenylmethyl]-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide.
| Compound Name | N-[(R)-(4-methoxyphenyl)-phenylmethyl]-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8709609 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[(R)-(4-methoxyphenyl)-phenylmethyl]-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide |
| SMILES | COc1ccc([C@H](NC(=O)CN2CCC[C@H]2c2cccs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N2O2S/c1-28-20-13-11-19(12-14-20)24(18-7-3-2-4-8-18)25-23(27)17-26-15-5-9-21(26)22-10-6-16-29-22/h2-4,6-8,10-14,16,21,24H,5,9,15,17H2,1H3,(H,25,27)/t21-,24+/m0/s1 |
| InChIKey | WPBDKNVLMQCNAY-XUZZJYLKSA-N |
| XLogP | 4.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |