C24H26N2OS — CID 11944117
(2R)-N-benzhydryl-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide (PubChem CID 11944117) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is (2R)-N-benzhydryl-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide.
| Compound Name | (2R)-N-benzhydryl-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 11944117 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (2R)-N-benzhydryl-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NC(c1ccccc1)c1ccccc1)N1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C24H26N2OS/c1-18(26-16-8-14-21(26)22-15-9-17-28-22)24(27)25-23(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-7,9-13,15,17-18,21,23H,8,14,16H2,1H3,(H,25,27)/t18-,21-/m1/s1 |
| InChIKey | YVIXBJHWCKLZMV-WIYYLYMNSA-N |
| XLogP | 5.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |