C18H19N3OS — CID 32735405
(2S)-N-(3-cyanophenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide (PubChem CID 32735405) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is (2S)-N-(3-cyanophenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide.
| Compound Name | (2S)-N-(3-cyanophenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 32735405 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2S)-N-(3-cyanophenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc(C#N)c1)N1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C18H19N3OS/c1-13(18(22)20-15-6-2-5-14(11-15)12-19)21-9-3-7-16(21)17-8-4-10-23-17/h2,4-6,8,10-11,13,16H,3,7,9H2,1H3,(H,20,22)/t13-,16+/m0/s1 |
| InChIKey | GZIGGMKMSKTHPD-XJKSGUPXSA-N |
| XLogP | 3.78 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |