C20H26N2OS — CID 11944107
(2R)-N-(4-propan-2-ylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide (PubChem CID 11944107) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is (2R)-N-(4-propan-2-ylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide.
| Compound Name | (2R)-N-(4-propan-2-ylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 11944107 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2R)-N-(4-propan-2-ylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
| SMILES | CC(C)c1ccc(NC(=O)[C@@H](C)N2CCC[C@@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C20H26N2OS/c1-14(2)16-8-10-17(11-9-16)21-20(23)15(3)22-12-4-6-18(22)19-7-5-13-24-19/h5,7-11,13-15,18H,4,6,12H2,1-3H3,(H,21,23)/t15-,18-/m1/s1 |
| InChIKey | IQVWAPBVWLXBPS-CRAIPNDOSA-N |
| XLogP | 5.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |