C23H24N2OS — CID 11944077
(2S)-N-(2-phenylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide (PubChem CID 11944077) has the molecular formula C23H24N2OS and a molecular weight of 376.53 g/mol. Its IUPAC name is (2S)-N-(2-phenylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide.
| Compound Name | (2S)-N-(2-phenylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 11944077 |
| Molecular Formula | C23H24N2OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (2S)-N-(2-phenylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccccc1-c1ccccc1)N1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C23H24N2OS/c1-17(25-15-7-13-21(25)22-14-8-16-27-22)23(26)24-20-12-6-5-11-19(20)18-9-3-2-4-10-18/h2-6,8-12,14,16-17,21H,7,13,15H2,1H3,(H,24,26)/t17-,21+/m0/s1 |
| InChIKey | HZXNNKSJHNHAKH-LAUBAEHRSA-N |
| XLogP | 5.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |