C21H30N2OS — CID 124839965
(2S)-N-(1-adamantyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide (PubChem CID 124839965) has the molecular formula C21H30N2OS and a molecular weight of 358.55 g/mol. Its IUPAC name is (2S)-N-(1-adamantyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide.
| Compound Name | (2S)-N-(1-adamantyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 124839965 |
| Molecular Formula | C21H30N2OS |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (2S)-N-(1-adamantyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)NC12CC3CC(CC(C3)C1)C2)N1CCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C21H30N2OS/c1-14(23-6-2-4-18(23)19-5-3-7-25-19)20(24)22-21-11-15-8-16(12-21)10-17(9-15)13-21/h3,5,7,14-18H,2,4,6,8-13H2,1H3,(H,22,24)/t14-,15?,16?,17?,18-,21?/m0/s1 |
| InChIKey | IFZOUZDBWPENAB-UWAICQJNSA-N |
| XLogP | 4.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |