C17H18F2N2OS — CID 24506963
N-(3,4-difluorophenyl)-2-(2-thiophen-2-ylpyrrolidin-1-yl)propanamide (PubChem CID 24506963) has the molecular formula C17H18F2N2OS and a molecular weight of 336.41 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-(2-thiophen-2-ylpyrrolidin-1-yl)propanamide.
| Compound Name | N-(3,4-difluorophenyl)-2-(2-thiophen-2-ylpyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 24506963 |
| Molecular Formula | C17H18F2N2OS |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-(2-thiophen-2-ylpyrrolidin-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(F)c(F)c1)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C17H18F2N2OS/c1-11(17(22)20-12-6-7-13(18)14(19)10-12)21-8-2-4-15(21)16-5-3-9-23-16/h3,5-7,9-11,15H,2,4,8H2,1H3,(H,20,22) |
| InChIKey | YVSUESLFLULNMS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |