C18H23N3O3 — CID 16554666
ethyl 1-[1-(3-cyanoanilino)-1-oxopropan-2-yl]piperidine-3-carboxylate (PubChem CID 16554666) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 1-[1-(3-cyanoanilino)-1-oxopropan-2-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-(3-cyanoanilino)-1-oxopropan-2-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 16554666 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | ethyl 1-[1-(3-cyanoanilino)-1-oxopropan-2-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(C)C(=O)Nc2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C18H23N3O3/c1-3-24-18(23)15-7-5-9-21(12-15)13(2)17(22)20-16-8-4-6-14(10-16)11-19/h4,6,8,10,13,15H,3,5,7,9,12H2,1-2H3,(H,20,22) |
| InChIKey | QQLNNUZXCLHMAA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |