C18H24N3O3+ — CID 8532003
ethyl (3R)-1-[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxylate (PubChem CID 8532003) has the molecular formula C18H24N3O3+ and a molecular weight of 330.41 g/mol. Its IUPAC name is ethyl (3R)-1-[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8532003 |
| Molecular Formula | C18H24N3O3+ |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | ethyl (3R)-1-[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+]([C@@H](C)C(=O)Nc2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C18H23N3O3/c1-3-24-18(23)15-7-5-9-21(12-15)13(2)17(22)20-16-8-4-6-14(10-16)11-19/h4,6,8,10,13,15H,3,5,7,9,12H2,1-2H3,(H,20,22)/p+1/t13-,15+/m0/s1 |
| InChIKey | QQLNNUZXCLHMAA-DZGCQCFKSA-O |
| XLogP | 0.74 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |