C18H22ClN3O3 — CID 9444799
ethyl (3R)-1-[(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl]piperidine-3-carboxylate (PubChem CID 9444799) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is ethyl (3R)-1-[(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 9444799 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | ethyl (3R)-1-[(2S)-1-(3-chloro-4-cyanoanilino)-1-oxopropan-2-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN([C@@H](C)C(=O)Nc2ccc(C#N)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H22ClN3O3/c1-3-25-18(24)14-5-4-8-22(11-14)12(2)17(23)21-15-7-6-13(10-20)16(19)9-15/h6-7,9,12,14H,3-5,8,11H2,1-2H3,(H,21,23)/t12-,14+/m0/s1 |
| InChIKey | POISIHSYJIIKDZ-GXTWGEPZSA-N |
| XLogP | 2.81 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |