C17H22ClN3O2 — CID 111114068
N-(3-chloro-4-cyanophenyl)-2-[4-(1-hydroxyethyl)piperidin-1-yl]propanamide (PubChem CID 111114068) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-[4-(1-hydroxyethyl)piperidin-1-yl]propanamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-[4-(1-hydroxyethyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 111114068 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-[4-(1-hydroxyethyl)piperidin-1-yl]propanamide |
| SMILES | CC(O)C1CCN(C(C)C(=O)Nc2ccc(C#N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H22ClN3O2/c1-11(21-7-5-13(6-8-21)12(2)22)17(23)20-15-4-3-14(10-19)16(18)9-15/h3-4,9,11-13,22H,5-8H2,1-2H3,(H,20,23) |
| InChIKey | ARDCGASZKBFHBV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |