C17H19F2NS — CID 92878210
(2R)-1-[(2,4-difluorophenyl)methyl]-2-thiophen-2-ylazepane (PubChem CID 92878210) has the molecular formula C17H19F2NS and a molecular weight of 307.41 g/mol. Its IUPAC name is (2R)-1-[(2,4-difluorophenyl)methyl]-2-thiophen-2-ylazepane.
| Compound Name | (2R)-1-[(2,4-difluorophenyl)methyl]-2-thiophen-2-ylazepane |
|---|---|
| PubChem CID | 92878210 |
| Molecular Formula | C17H19F2NS |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (2R)-1-[(2,4-difluorophenyl)methyl]-2-thiophen-2-ylazepane |
| SMILES | Fc1ccc(CN2CCCCC[C@@H]2c2cccs2)c(F)c1 |
| InChI | InChI=1S/C17H19F2NS/c18-14-8-7-13(15(19)11-14)12-20-9-3-1-2-5-16(20)17-6-4-10-21-17/h4,6-8,10-11,16H,1-3,5,9,12H2/t16-/m1/s1 |
| InChIKey | ZZAWGARLQYGEDW-MRXNPFEDSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |