C21H25N3S — CID 46366465
1-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-2-thiophen-2-ylazepane (PubChem CID 46366465) has the molecular formula C21H25N3S and a molecular weight of 351.52 g/mol. Its IUPAC name is 1-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-2-thiophen-2-ylazepane.
| Compound Name | 1-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-2-thiophen-2-ylazepane |
|---|---|
| PubChem CID | 46366465 |
| Molecular Formula | C21H25N3S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-2-thiophen-2-ylazepane |
| SMILES | Cc1ccc(-c2[nH]ncc2CN2CCCCCC2c2cccs2)cc1 |
| InChI | InChI=1S/C21H25N3S/c1-16-8-10-17(11-9-16)21-18(14-22-23-21)15-24-12-4-2-3-6-19(24)20-7-5-13-25-20/h5,7-11,13-14,19H,2-4,6,12,15H2,1H3,(H,22,23) |
| InChIKey | FIIKCJRQASLZLQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |