C17H20BrNS — CID 92878093
(2S)-1-[(4-bromophenyl)methyl]-2-thiophen-2-ylazepane (PubChem CID 92878093) has the molecular formula C17H20BrNS and a molecular weight of 350.32 g/mol. Its IUPAC name is (2S)-1-[(4-bromophenyl)methyl]-2-thiophen-2-ylazepane.
| Compound Name | (2S)-1-[(4-bromophenyl)methyl]-2-thiophen-2-ylazepane |
|---|---|
| PubChem CID | 92878093 |
| Molecular Formula | C17H20BrNS |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | (2S)-1-[(4-bromophenyl)methyl]-2-thiophen-2-ylazepane |
| SMILES | Brc1ccc(CN2CCCCC[C@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C17H20BrNS/c18-15-9-7-14(8-10-15)13-19-11-3-1-2-5-16(19)17-6-4-12-20-17/h4,6-10,12,16H,1-3,5,11,13H2/t16-/m0/s1 |
| InChIKey | ZHLGCRGUNOLQSX-INIZCTEOSA-N |
| XLogP | 5.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |