C21H27N3OS — CID 8539041
N-[4-(pyrrolidin-1-ylmethyl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide (PubChem CID 8539041) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is N-[4-(pyrrolidin-1-ylmethyl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide.
| Compound Name | N-[4-(pyrrolidin-1-ylmethyl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8539041 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[4-(pyrrolidin-1-ylmethyl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC[C@@H]1c1cccs1)Nc1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C21H27N3OS/c25-21(16-24-13-3-5-19(24)20-6-4-14-26-20)22-18-9-7-17(8-10-18)15-23-11-1-2-12-23/h4,6-10,14,19H,1-3,5,11-13,15-16H2,(H,22,25)/t19-/m1/s1 |
| InChIKey | YLUJEXGWJSLLJP-LJQANCHMSA-N |
| XLogP | 4.12 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |