C17H21N3O3S2 — CID 30101437
N-(4-sulfamoylphenyl)-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide (PubChem CID 30101437) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide.
| Compound Name | N-(4-sulfamoylphenyl)-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 30101437 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(4-sulfamoylphenyl)-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCN2CCC[C@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C17H21N3O3S2/c18-25(22,23)14-7-5-13(6-8-14)19-17(21)9-11-20-10-1-3-15(20)16-4-2-12-24-16/h2,4-8,12,15H,1,3,9-11H2,(H,19,21)(H2,18,22,23)/t15-/m0/s1 |
| InChIKey | IVKAOXGJVSDQKG-HNNXBMFYSA-N |
| XLogP | 2.56 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |