C20H25N3O3S2 — CID 9166137
N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide (PubChem CID 9166137) has the molecular formula C20H25N3O3S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide.
| Compound Name | N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 9166137 |
| Molecular Formula | C20H25N3O3S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC[C@@H]1c1cccs1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H25N3O3S2/c24-20(15-22-11-3-5-18(22)19-6-4-14-27-19)21-16-7-9-17(10-8-16)28(25,26)23-12-1-2-13-23/h4,6-10,14,18H,1-3,5,11-13,15H2,(H,21,24)/t18-/m1/s1 |
| InChIKey | MYDVYHQJMUZEIZ-GOSISDBHSA-N |
| XLogP | 3.31 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |