C18H23ClN3O3S2- — CID 53347816
N-(4-piperidin-1-ylsulfonylphenyl)-2-(thiophen-2-ylmethylamino)acetamide chloride (PubChem CID 53347816) has the molecular formula C18H23ClN3O3S2- and a molecular weight of 428.99 g/mol. Its IUPAC name is N-(4-piperidin-1-ylsulfonylphenyl)-2-(thiophen-2-ylmethylamino)acetamide chloride.
| Compound Name | N-(4-piperidin-1-ylsulfonylphenyl)-2-(thiophen-2-ylmethylamino)acetamide chloride |
|---|---|
| PubChem CID | 53347816 |
| Molecular Formula | C18H23ClN3O3S2- |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-(4-piperidin-1-ylsulfonylphenyl)-2-(thiophen-2-ylmethylamino)acetamide chloride |
| SMILES | O=C(CNCc1cccs1)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1.[Cl-] |
| InChI | InChI=1S/C18H23N3O3S2.ClH/c22-18(14-19-13-16-5-4-12-25-16)20-15-6-8-17(9-7-15)26(23,24)21-10-2-1-3-11-21;/h4-9,12,19H,1-3,10-11,13-14H2,(H,20,22);1H/p-1 |
| InChIKey | QEHZTNIBNZLAIA-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |