C17H16ClN3OS — CID 9445827
N-(3-chloro-4-cyanophenyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide (PubChem CID 9445827) has the molecular formula C17H16ClN3OS and a molecular weight of 345.86 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 9445827 |
| Molecular Formula | C17H16ClN3OS |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide |
| SMILES | N#Cc1ccc(NC(=O)CN2CCC[C@H]2c2cccs2)cc1Cl |
| InChI | InChI=1S/C17H16ClN3OS/c18-14-9-13(6-5-12(14)10-19)20-17(22)11-21-7-1-3-15(21)16-4-2-8-23-16/h2,4-6,8-9,15H,1,3,7,11H2,(H,20,22)/t15-/m0/s1 |
| InChIKey | QRCONFGWIYKXIM-HNNXBMFYSA-N |
| XLogP | 4.05 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |