C18H19N3OS2 — CID 9446247
N-[2-(cyanomethylsulfanyl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide (PubChem CID 9446247) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 9446247 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]acetamide |
| SMILES | N#CCSc1ccccc1NC(=O)CN1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C18H19N3OS2/c19-9-12-24-16-7-2-1-5-14(16)20-18(22)13-21-10-3-6-15(21)17-8-4-11-23-17/h1-2,4-5,7-8,11,15H,3,6,10,12-13H2,(H,20,22)/t15-/m1/s1 |
| InChIKey | VCCJMIPCBAYWQE-OAHLLOKOSA-N |
| XLogP | 4.14 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |