C22H27N3O2S — CID 9166376
N-cyclopentyl-2-[[2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetyl]amino]benzamide (PubChem CID 9166376) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 9166376 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-cyclopentyl-2-[[2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetyl]amino]benzamide |
| SMILES | O=C(CN1CCC[C@H]1c1cccs1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H27N3O2S/c26-21(15-25-13-5-11-19(25)20-12-6-14-28-20)24-18-10-4-3-9-17(18)22(27)23-16-7-1-2-8-16/h3-4,6,9-10,12,14,16,19H,1-2,5,7-8,11,13,15H2,(H,23,27)(H,24,26)/t19-/m0/s1 |
| InChIKey | HHGYCHXJYRFNSS-IBGZPJMESA-N |
| XLogP | 4.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |