C25H27N3O2S — CID 41184047
N-(2-phenylethyl)-2-[[2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetyl]amino]benzamide (PubChem CID 41184047) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-[[2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-(2-phenylethyl)-2-[[2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 41184047 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-(2-phenylethyl)-2-[[2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]acetyl]amino]benzamide |
| SMILES | O=C(CN1CCC[C@H]1c1cccs1)Nc1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C25H27N3O2S/c29-24(18-28-16-6-12-22(28)23-13-7-17-31-23)27-21-11-5-4-10-20(21)25(30)26-15-14-19-8-2-1-3-9-19/h1-5,7-11,13,17,22H,6,12,14-16,18H2,(H,26,30)(H,27,29)/t22-/m0/s1 |
| InChIKey | MWVKQXIEFKXZEW-QFIPXVFZSA-N |
| XLogP | 4.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |