C22H26N4O3S — CID 17423661
N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-(2-thiophen-2-ylpyrrolidin-1-yl)acetamide (PubChem CID 17423661) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-(2-thiophen-2-ylpyrrolidin-1-yl)acetamide.
| Compound Name | N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-(2-thiophen-2-ylpyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 17423661 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-(2-thiophen-2-ylpyrrolidin-1-yl)acetamide |
| SMILES | CC1(CCc2ccccc2)NC(=O)N(NC(=O)CN2CCCC2c2cccs2)C1=O |
| InChI | InChI=1S/C22H26N4O3S/c1-22(12-11-16-7-3-2-4-8-16)20(28)26(21(29)23-22)24-19(27)15-25-13-5-9-17(25)18-10-6-14-30-18/h2-4,6-8,10,14,17H,5,9,11-13,15H2,1H3,(H,23,29)(H,24,27) |
| InChIKey | YRQLMNONXCGWBO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|