C26H31N5O4 — CID 16580785
N-[1-[2-[[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl]piperidin-4-yl]benzamide (PubChem CID 16580785) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[1-[2-[[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[2-[[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 16580785 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-[1-[2-[[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl]piperidin-4-yl]benzamide |
| SMILES | CC1(CCc2ccccc2)NC(=O)N(NC(=O)CN2CCC(NC(=O)c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C26H31N5O4/c1-26(15-12-19-8-4-2-5-9-19)24(34)31(25(35)28-26)29-22(32)18-30-16-13-21(14-17-30)27-23(33)20-10-6-3-7-11-20/h2-11,21H,12-18H2,1H3,(H,27,33)(H,28,35)(H,29,32) |
| InChIKey | USTRNQYEWUVMNU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|